C22H30N4O3 — CID 7316987
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide (PubChem CID 7316987) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 7316987 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-4-[2-(2-indol-1-ylacetyl)hydrazinyl]-4-oxobutanamide |
| SMILES | CC1[C@H](C)CCC[C@H]1NC(=O)CCC(=O)NNC(=O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C22H30N4O3/c1-15-6-5-8-18(16(15)2)23-20(27)10-11-21(28)24-25-22(29)14-26-13-12-17-7-3-4-9-19(17)26/h3-4,7,9,12-13,15-16,18H,5-6,8,10-11,14H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)/t15-,16?,18-/m1/s1 |
| InChIKey | ZILMRPFOIUHSHP-IFJNFQAOSA-N |
| XLogP | 2.51 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|