C16H21N3O2S2 — CID 11916577
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 11916577) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 11916577 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CSc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-10-5-3-6-12(11(10)2)17-14(20)9-23-16-19-18-15(21-16)13-7-4-8-22-13/h4,7-8,10-12H,3,5-6,9H2,1-2H3,(H,17,20)/t10-,11-,12+/m1/s1 |
| InChIKey | STACTNWNQXRPHF-UTUOFQBUSA-N |
| XLogP | 3.83 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |