C18H22ClN3O2S — CID 11911457
2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11911457) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11911457 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)CSc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-11-5-3-8-15(12(11)2)20-16(23)10-25-18-22-21-17(24-18)13-6-4-7-14(19)9-13/h4,6-7,9,11-12,15H,3,5,8,10H2,1-2H3,(H,20,23)/t11-,12-,15+/m1/s1 |
| InChIKey | FJXMWPOMHOXVQB-JMSVASOKSA-N |
| XLogP | 4.42 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |