C11H16N2OS — CID 63251271
N-(2-aminocyclopentyl)-2-thiophen-2-ylacetamide (PubChem CID 63251271) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-(2-aminocyclopentyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(2-aminocyclopentyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 63251271 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(2-aminocyclopentyl)-2-thiophen-2-ylacetamide |
| SMILES | NC1CCCC1NC(=O)Cc1cccs1 |
| InChI | InChI=1S/C11H16N2OS/c12-9-4-1-5-10(9)13-11(14)7-8-3-2-6-15-8/h2-3,6,9-10H,1,4-5,7,12H2,(H,13,14) |
| InChIKey | NBLJGZVXSKDAPC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |