C14H20N2O2S — CID 122560557
N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 122560557) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 122560557 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)N[C@H]1COC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C14H20N2O2S/c17-14(8-11-4-3-7-19-11)15-12-9-18-10-13(12)16-5-1-2-6-16/h3-4,7,12-13H,1-2,5-6,8-10H2,(H,15,17)/t12-,13-/m0/s1 |
| InChIKey | PNHXTMJEWQVYKD-STQMWFEESA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |