C15H20N2O3S — CID 91789169
5-acetyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]thiophene-2-carboxamide (PubChem CID 91789169) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 5-acetyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91789169 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5-acetyl-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)N[C@H]2COC[C@@H]2N2CCCC2)s1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10(18)13-4-5-14(21-13)15(19)16-11-8-20-9-12(11)17-6-2-3-7-17/h4-5,11-12H,2-3,6-9H2,1H3,(H,16,19)/t11-,12-/m0/s1 |
| InChIKey | CHDCYFZPJQSPCJ-RYUDHWBXSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |