C16H23N3O3 — CID 133267819
2-methoxy-N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide (PubChem CID 133267819) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-methoxy-N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-methoxy-N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133267819 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-methoxy-N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)N[C@@H]1COC[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C16H23N3O3/c1-21-16-12(6-5-7-17-16)15(20)18-13-10-22-11-14(13)19-8-3-2-4-9-19/h5-7,13-14H,2-4,8-11H2,1H3,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | VYMPUFFALRMJNI-ZIAGYGMSSA-N |
| XLogP | 1.07 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |