C18H24N2O5 — CID 118772644
3-methoxy-5-[[(3R,4R)-4-piperidin-1-yloxolan-3-yl]carbamoyl]benzoic acid (PubChem CID 118772644) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-methoxy-5-[[(3R,4R)-4-piperidin-1-yloxolan-3-yl]carbamoyl]benzoic acid.
| Compound Name | 3-methoxy-5-[[(3R,4R)-4-piperidin-1-yloxolan-3-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 118772644 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-methoxy-5-[[(3R,4R)-4-piperidin-1-yloxolan-3-yl]carbamoyl]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc(C(=O)N[C@H]2COC[C@@H]2N2CCCCC2)c1 |
| InChI | InChI=1S/C18H24N2O5/c1-24-14-8-12(7-13(9-14)18(22)23)17(21)19-15-10-25-11-16(15)20-5-3-2-4-6-20/h7-9,15-16H,2-6,10-11H2,1H3,(H,19,21)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | JDAVSDCLYAPZGQ-HOTGVXAUSA-N |
| XLogP | 1.38 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |