C18H26N2O4 — CID 110128022
N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-methoxybenzamide (PubChem CID 110128022) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-methoxybenzamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 110128022 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-morpholin-4-ylcyclohexyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H]2CCC[C@@H](N3CCOCC3)[C@@H]2O)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-23-14-5-2-4-13(12-14)18(22)19-15-6-3-7-16(17(15)21)20-8-10-24-11-9-20/h2,4-5,12,15-17,21H,3,6-11H2,1H3,(H,19,22)/t15-,16-,17-/m1/s1 |
| InChIKey | FWBQQPQRBZCIDQ-BRWVUGGUSA-N |
| XLogP | 1.04 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |