C24H30N2O4 — CID 110153321
N-[(1R,2S,3R,4R)-3-hydroxy-4-phenoxy-2-piperidin-1-ylcyclopentyl]-3-methoxybenzamide (PubChem CID 110153321) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-3-hydroxy-4-phenoxy-2-piperidin-1-ylcyclopentyl]-3-methoxybenzamide.
| Compound Name | N-[(1R,2S,3R,4R)-3-hydroxy-4-phenoxy-2-piperidin-1-ylcyclopentyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 110153321 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[(1R,2S,3R,4R)-3-hydroxy-4-phenoxy-2-piperidin-1-ylcyclopentyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N[C@@H]2C[C@@H](Oc3ccccc3)[C@H](O)[C@H]2N2CCCCC2)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-29-19-12-8-9-17(15-19)24(28)25-20-16-21(30-18-10-4-2-5-11-18)23(27)22(20)26-13-6-3-7-14-26/h2,4-5,8-12,15,20-23,27H,3,6-7,13-14,16H2,1H3,(H,25,28)/t20-,21-,22+,23+/m1/s1 |
| InChIKey | MLGGFMWOCKTFLA-LUKWVAJMSA-N |
| XLogP | 2.86 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |