C17H25N3O3 — CID 119070601
3-(2-aminoethoxy)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide (PubChem CID 119070601) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide.
| Compound Name | 3-(2-aminoethoxy)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 119070601 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-(2-aminoethoxy)-N-[(3R,4R)-4-pyrrolidin-1-yloxolan-3-yl]benzamide |
| SMILES | NCCOc1cccc(C(=O)N[C@H]2COC[C@@H]2N2CCCC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c18-6-9-23-14-5-3-4-13(10-14)17(21)19-15-11-22-12-16(15)20-7-1-2-8-20/h3-5,10,15-16H,1-2,6-9,11-12,18H2,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | UDMDGHHNCSNUOU-HOTGVXAUSA-N |
| XLogP | 0.62 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |