C18H26N2O3 — CID 91788231
3-phenoxy-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]propanamide (PubChem CID 91788231) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-phenoxy-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]propanamide.
| Compound Name | 3-phenoxy-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 91788231 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-phenoxy-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]propanamide |
| SMILES | O=C(CCOc1ccccc1)N[C@H]1COC[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C18H26N2O3/c21-18(9-12-23-15-7-3-1-4-8-15)19-16-13-22-14-17(16)20-10-5-2-6-11-20/h1,3-4,7-8,16-17H,2,5-6,9-14H2,(H,19,21)/t16-,17-/m0/s1 |
| InChIKey | KQJWJIGYZBLJAP-IRXDYDNUSA-N |
| XLogP | 1.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |