C18H23F3N2O2 — CID 133266900
N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 133266900) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 133266900 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N[C@@H]1COC[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)14-6-4-5-13(9-14)10-17(24)22-15-11-25-12-16(15)23-7-2-1-3-8-23/h4-6,9,15-16H,1-3,7-8,10-12H2,(H,22,24)/t15-,16-/m1/s1 |
| InChIKey | LFSVVGPZSLKEKF-HZPDHXFCSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |