C20H28N2O4 — CID 133139049
N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-(4-propanoylphenoxy)acetamide (PubChem CID 133139049) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-(4-propanoylphenoxy)acetamide.
| Compound Name | N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-(4-propanoylphenoxy)acetamide |
|---|---|
| PubChem CID | 133139049 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-[(3S,4S)-4-piperidin-1-yloxolan-3-yl]-2-(4-propanoylphenoxy)acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)N[C@@H]2COC[C@H]2N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O4/c1-2-19(23)15-6-8-16(9-7-15)26-14-20(24)21-17-12-25-13-18(17)22-10-4-3-5-11-22/h6-9,17-18H,2-5,10-14H2,1H3,(H,21,24)/t17-,18-/m1/s1 |
| InChIKey | SOTJKIQLORFGBU-QZTJIDSGSA-N |
| XLogP | 2.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |