C27H32F3N3O2 — CID 138713660
1-[(8R)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 138713660) has the molecular formula C27H32F3N3O2 and a molecular weight of 487.57 g/mol. Its IUPAC name is 1-[(8R)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[(8R)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 138713660 |
| Molecular Formula | C27H32F3N3O2 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 1-[(8R)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)N1CCN(Cc2ccccc2)C2COC[C@H](N3CCCC3)C21 |
| InChI | InChI=1S/C27H32F3N3O2/c28-27(29,30)22-10-6-9-21(15-22)16-25(34)33-14-13-32(17-20-7-2-1-3-8-20)24-19-35-18-23(26(24)33)31-11-4-5-12-31/h1-3,6-10,15,23-24,26H,4-5,11-14,16-19H2/t23-,24?,26?/m0/s1 |
| InChIKey | BYWKIKFGKPYHSN-JHUWLELGSA-N |
| XLogP | 3.82 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |