C26H31Cl2N3O2 — CID 138713256
1-[(8R,8aR)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 138713256) has the molecular formula C26H31Cl2N3O2 and a molecular weight of 488.46 g/mol. Its IUPAC name is 1-[(8R,8aR)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(8R,8aR)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 138713256 |
| Molecular Formula | C26H31Cl2N3O2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 1-[(8R,8aR)-4-benzyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(Cc2ccccc2)C2COC[C@H](N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C26H31Cl2N3O2/c27-21-9-8-20(14-22(21)28)15-25(32)31-13-12-30(16-19-6-2-1-3-7-19)24-18-33-17-23(26(24)31)29-10-4-5-11-29/h1-3,6-9,14,23-24,26H,4-5,10-13,15-18H2/t23-,24?,26+/m0/s1 |
| InChIKey | QLMYFCBXGDBGLL-JNOFKKGSSA-N |
| XLogP | 4.11 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |