C25H30Cl2N4O2 — CID 155379064
1-[(8R,8aR)-4-(pyridin-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 155379064) has the molecular formula C25H30Cl2N4O2 and a molecular weight of 489.45 g/mol. Its IUPAC name is 1-[(8R,8aR)-4-(pyridin-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(8R,8aR)-4-(pyridin-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 155379064 |
| Molecular Formula | C25H30Cl2N4O2 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 1-[(8R,8aR)-4-(pyridin-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(Cc2ccccn2)C2COC[C@H](N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C25H30Cl2N4O2/c26-20-7-6-18(13-21(20)27)14-24(32)31-12-11-30(15-19-5-1-2-8-28-19)23-17-33-16-22(25(23)31)29-9-3-4-10-29/h1-2,5-8,13,22-23,25H,3-4,9-12,14-17H2/t22-,23?,25+/m0/s1 |
| InChIKey | MJSHTAFIPMQESE-OPEVTLNRSA-N |
| XLogP | 3.51 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |