C25H34Cl2N4O3 — CID 165381939
1-[(4aS,8aR)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 165381939) has the molecular formula C25H34Cl2N4O3 and a molecular weight of 509.48 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(4aS,8aR)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 165381939 |
| Molecular Formula | C25H34Cl2N4O3 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 1-[(4aS,8aR)-4-(2-oxo-2-pyrrolidin-1-ylethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(CN1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)[C@@H]2C(N3CCCC3)COC[C@H]21)N1CCCC1 |
| InChI | InChI=1S/C25H34Cl2N4O3/c26-19-6-5-18(13-20(19)27)14-23(32)31-12-11-30(15-24(33)29-9-3-4-10-29)22-17-34-16-21(25(22)31)28-7-1-2-8-28/h5-6,13,21-22,25H,1-4,7-12,14-17H2/t21?,22-,25-/m1/s1 |
| InChIKey | GLHSTRZKYCABPM-HIAQKOENSA-N |
| XLogP | 2.53 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |