C24H33Cl2N3O3 — CID 155378889
1-[(8aR)-4-(oxolan-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 155378889) has the molecular formula C24H33Cl2N3O3 and a molecular weight of 482.45 g/mol. Its IUPAC name is 1-[(8aR)-4-(oxolan-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(8aR)-4-(oxolan-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 155378889 |
| Molecular Formula | C24H33Cl2N3O3 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 1-[(8aR)-4-(oxolan-2-ylmethyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(CC2CCCO2)C2COCC(N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C24H33Cl2N3O3/c25-19-6-5-17(12-20(19)26)13-23(30)29-10-9-28(14-18-4-3-11-32-18)22-16-31-15-21(24(22)29)27-7-1-2-8-27/h5-6,12,18,21-22,24H,1-4,7-11,13-16H2/t18?,21?,22?,24-/m1/s1 |
| InChIKey | BAJPYVOTTFYVGV-OSRKUIHLSA-N |
| XLogP | 3.09 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |