C20H27Cl2N3O2 — CID 138712809
1-[(4aS,8R)-4-methyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 138712809) has the molecular formula C20H27Cl2N3O2 and a molecular weight of 412.36 g/mol. Its IUPAC name is 1-[(4aS,8R)-4-methyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(4aS,8R)-4-methyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 138712809 |
| Molecular Formula | C20H27Cl2N3O2 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[(4aS,8R)-4-methyl-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | CN1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)C2[C@H]1COC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C20H27Cl2N3O2/c1-23-8-9-25(19(26)11-14-4-5-15(21)16(22)10-14)20-17(23)12-27-13-18(20)24-6-2-3-7-24/h4-5,10,17-18,20H,2-3,6-9,11-13H2,1H3/t17-,18+,20?/m1/s1 |
| InChIKey | PAXTXQWDDJKQSF-ZOVQDZKKSA-N |
| XLogP | 2.54 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |