C25H33Cl2N3O4 — CID 155378900
1-[(8aR)-4-(1-hydroxycyclopentanecarbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 155378900) has the molecular formula C25H33Cl2N3O4 and a molecular weight of 510.46 g/mol. Its IUPAC name is 1-[(8aR)-4-(1-hydroxycyclopentanecarbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(8aR)-4-(1-hydroxycyclopentanecarbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 155378900 |
| Molecular Formula | C25H33Cl2N3O4 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 1-[(8aR)-4-(1-hydroxycyclopentanecarbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(C(=O)C2(O)CCCC2)C2COCC(N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C25H33Cl2N3O4/c26-18-6-5-17(13-19(18)27)14-22(31)30-12-11-29(24(32)25(33)7-1-2-8-25)21-16-34-15-20(23(21)30)28-9-3-4-10-28/h5-6,13,20-21,23,33H,1-4,7-12,14-16H2/t20?,21?,23-/m1/s1 |
| InChIKey | SFBZRHMGHVPPRX-YDPRHXJPSA-N |
| XLogP | 2.74 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |