C23H27Cl2N5O3 — CID 165381945
1-[(4aS,8R,8aR)-4-(1H-pyrazole-5-carbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 165381945) has the molecular formula C23H27Cl2N5O3 and a molecular weight of 492.41 g/mol. Its IUPAC name is 1-[(4aS,8R,8aR)-4-(1H-pyrazole-5-carbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(4aS,8R,8aR)-4-(1H-pyrazole-5-carbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 165381945 |
| Molecular Formula | C23H27Cl2N5O3 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 1-[(4aS,8R,8aR)-4-(1H-pyrazole-5-carbonyl)-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCN(C(=O)c2ccn[nH]2)[C@@H]2COC[C@H](N3CCCC3)[C@H]21 |
| InChI | InChI=1S/C23H27Cl2N5O3/c24-16-4-3-15(11-17(16)25)12-21(31)30-10-9-29(23(32)18-5-6-26-27-18)20-14-33-13-19(22(20)30)28-7-1-2-8-28/h3-6,11,19-20,22H,1-2,7-10,12-14H2,(H,26,27)/t19-,20+,22+/m0/s1 |
| InChIKey | GGKVXYYSQOOMKP-TUNNFDKTSA-N |
| XLogP | 2.48 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |