C21H28Cl2N4O3 — CID 167684044
2-[(4aS,8R,8aR)-1-[2-(3,4-dichlorophenyl)acetyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-4-yl]acetamide (PubChem CID 167684044) has the molecular formula C21H28Cl2N4O3 and a molecular weight of 455.39 g/mol. Its IUPAC name is 2-[(4aS,8R,8aR)-1-[2-(3,4-dichlorophenyl)acetyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-4-yl]acetamide.
| Compound Name | 2-[(4aS,8R,8aR)-1-[2-(3,4-dichlorophenyl)acetyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-4-yl]acetamide |
|---|---|
| PubChem CID | 167684044 |
| Molecular Formula | C21H28Cl2N4O3 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[(4aS,8R,8aR)-1-[2-(3,4-dichlorophenyl)acetyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-4-yl]acetamide |
| SMILES | NC(=O)CN1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2)[C@H]2[C@H]1COC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C21H28Cl2N4O3/c22-15-4-3-14(9-16(15)23)10-20(29)27-8-7-26(11-19(24)28)18-13-30-12-17(21(18)27)25-5-1-2-6-25/h3-4,9,17-18,21H,1-2,5-8,10-13H2,(H2,24,28)/t17-,18+,21+/m0/s1 |
| InChIKey | VYNVVMRHJUOUPM-WAOWUJCRSA-N |
| XLogP | 1.40 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |