C24H31Cl2N5O2 — CID 155378787
1-[(8aR)-4-[(1-methylpyrazol-4-yl)methyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone (PubChem CID 155378787) has the molecular formula C24H31Cl2N5O2 and a molecular weight of 492.45 g/mol. Its IUPAC name is 1-[(8aR)-4-[(1-methylpyrazol-4-yl)methyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-[(8aR)-4-[(1-methylpyrazol-4-yl)methyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 155378787 |
| Molecular Formula | C24H31Cl2N5O2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1-[(8aR)-4-[(1-methylpyrazol-4-yl)methyl]-8-pyrrolidin-1-yl-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b]pyrazin-1-yl]-2-(3,4-dichlorophenyl)ethanone |
| SMILES | Cn1cc(CN2CCN(C(=O)Cc3ccc(Cl)c(Cl)c3)[C@@H]3C(N4CCCC4)COCC32)cn1 |
| InChI | InChI=1S/C24H31Cl2N5O2/c1-28-13-18(12-27-28)14-30-8-9-31(23(32)11-17-4-5-19(25)20(26)10-17)24-21(15-33-16-22(24)30)29-6-2-3-7-29/h4-5,10,12-13,21-22,24H,2-3,6-9,11,14-16H2,1H3/t21?,22?,24-/m1/s1 |
| InChIKey | LYLMBWWGRMITCX-UBVWURDFSA-N |
| XLogP | 2.85 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |