C16H20N4O2 — CID 91843333
6-cyano-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide (PubChem CID 91843333) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 6-cyano-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91843333 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 6-cyano-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]pyridine-3-carboxamide |
| SMILES | N#Cc1ccc(C(=O)N[C@H]2COC[C@@H]2N2CCCCC2)cn1 |
| InChI | InChI=1S/C16H20N4O2/c17-8-13-5-4-12(9-18-13)16(21)19-14-10-22-11-15(14)20-6-2-1-3-7-20/h4-5,9,14-15H,1-3,6-7,10-11H2,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | GPCSWXPRCJJUJK-GJZGRUSLSA-N |
| XLogP | 0.94 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |