C16H22N2O3S — CID 118790643
5-acetyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]thiophene-2-carboxamide (PubChem CID 118790643) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 5-acetyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 118790643 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 5-acetyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)N[C@H]2COC[C@@H]2N2CCCCC2)s1 |
| InChI | InChI=1S/C16H22N2O3S/c1-11(19)14-5-6-15(22-14)16(20)17-12-9-21-10-13(12)18-7-3-2-4-8-18/h5-6,12-13H,2-4,7-10H2,1H3,(H,17,20)/t12-,13-/m0/s1 |
| InChIKey | YJJWYZYKVFVUNL-STQMWFEESA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |