C19H25N3O2 — CID 91841039
1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-2-carboxamide (PubChem CID 91841039) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-2-carboxamide |
|---|---|
| PubChem CID | 91841039 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-methyl-N-[(3R,4R)-4-piperidin-1-yloxolan-3-yl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@H]2COC[C@@H]2N2CCCCC2)cc2ccccc21 |
| InChI | InChI=1S/C19H25N3O2/c1-21-16-8-4-3-7-14(16)11-17(21)19(23)20-15-12-24-13-18(15)22-9-5-2-6-10-22/h3-4,7-8,11,15,18H,2,5-6,9-10,12-13H2,1H3,(H,20,23)/t15-,18-/m0/s1 |
| InChIKey | VQDRBPNMELJNLV-YJBOKZPZSA-N |
| XLogP | 2.16 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |