C19H23N3O2 — CID 133138704
1-naphthalen-2-yl-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea (PubChem CID 133138704) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-naphthalen-2-yl-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea.
| Compound Name | 1-naphthalen-2-yl-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea |
|---|---|
| PubChem CID | 133138704 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 1-naphthalen-2-yl-3-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]urea |
| SMILES | O=C(Nc1ccc2ccccc2c1)N[C@@H]1COC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C19H23N3O2/c23-19(20-16-8-7-14-5-1-2-6-15(14)11-16)21-17-12-24-13-18(17)22-9-3-4-10-22/h1-2,5-8,11,17-18H,3-4,9-10,12-13H2,(H2,20,21,23)/t17-,18-/m1/s1 |
| InChIKey | WUNCZZYONVDSPD-QZTJIDSGSA-N |
| XLogP | 2.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |