C17H22ClN3O5 — CID 133129286
methyl 2-chloro-5-[[(3S,4S)-4-morpholin-4-yloxolan-3-yl]carbamoylamino]benzoate (PubChem CID 133129286) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is methyl 2-chloro-5-[[(3S,4S)-4-morpholin-4-yloxolan-3-yl]carbamoylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[[(3S,4S)-4-morpholin-4-yloxolan-3-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 133129286 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl 2-chloro-5-[[(3S,4S)-4-morpholin-4-yloxolan-3-yl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)N[C@@H]2COC[C@H]2N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C17H22ClN3O5/c1-24-16(22)12-8-11(2-3-13(12)18)19-17(23)20-14-9-26-10-15(14)21-4-6-25-7-5-21/h2-3,8,14-15H,4-7,9-10H2,1H3,(H2,19,20,23)/t14-,15-/m1/s1 |
| InChIKey | PLTPLSYETNBHSG-HUUCEWRRSA-N |
| XLogP | 1.35 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |