C16H19ClN2O4 — CID 34160565
methyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-2-chlorobenzoate (PubChem CID 34160565) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is methyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-2-chlorobenzoate.
| Compound Name | methyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 34160565 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl 5-[(1-acetylpiperidine-4-carbonyl)amino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)C2CCN(C(C)=O)CC2)ccc1Cl |
| InChI | InChI=1S/C16H19ClN2O4/c1-10(20)19-7-5-11(6-8-19)15(21)18-12-3-4-14(17)13(9-12)16(22)23-2/h3-4,9,11H,5-8H2,1-2H3,(H,18,21) |
| InChIKey | FVCRDFYBVLUCPB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |