C17H23ClN4O3 — CID 72845264
methyl 5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]carbamoylamino]-2-chlorobenzoate (PubChem CID 72845264) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is methyl 5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]carbamoylamino]-2-chlorobenzoate.
| Compound Name | methyl 5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]carbamoylamino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 72845264 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | methyl 5-[[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]carbamoylamino]-2-chlorobenzoate |
| SMILES | COC(=O)c1cc(NC(=O)N[C@H]2C[C@H]3CN(C)CCN3C2)ccc1Cl |
| InChI | InChI=1S/C17H23ClN4O3/c1-21-5-6-22-9-12(7-13(22)10-21)20-17(24)19-11-3-4-15(18)14(8-11)16(23)25-2/h3-4,8,12-13H,5-7,9-10H2,1-2H3,(H2,19,20,24)/t12-,13-/m0/s1 |
| InChIKey | VSMOHUKJMDCNOB-STQMWFEESA-N |
| XLogP | 1.64 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |