C12H18ClN5O — CID 56740040
N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-chloro-1H-pyrazole-5-carboxamide (PubChem CID 56740040) has the molecular formula C12H18ClN5O and a molecular weight of 283.76 g/mol. Its IUPAC name is N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-chloro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-chloro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 56740040 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[(7S,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl]-4-chloro-1H-pyrazole-5-carboxamide |
| SMILES | CN1CCN2C[C@@H](NC(=O)c3[nH]ncc3Cl)C[C@H]2C1 |
| InChI | InChI=1S/C12H18ClN5O/c1-17-2-3-18-6-8(4-9(18)7-17)15-12(19)11-10(13)5-14-16-11/h5,8-9H,2-4,6-7H2,1H3,(H,14,16)(H,15,19)/t8-,9-/m0/s1 |
| InChIKey | DQCFUSWFEYTJMW-IUCAKERBSA-N |
| XLogP | 0.18 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |