C9H19N3O2S — CID 155419856
N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)methanesulfonamide (PubChem CID 155419856) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)methanesulfonamide.
| Compound Name | N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)methanesulfonamide |
|---|---|
| PubChem CID | 155419856 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)methanesulfonamide |
| SMILES | CN1CCN2CC(NS(C)(=O)=O)CC2C1 |
| InChI | InChI=1S/C9H19N3O2S/c1-11-3-4-12-6-8(5-9(12)7-11)10-15(2,13)14/h8-10H,3-7H2,1-2H3 |
| InChIKey | JLZMERZOGFLKBD-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |