C11H18N4S — CID 72528039
N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-1,3-thiazol-2-amine (PubChem CID 72528039) has the molecular formula C11H18N4S and a molecular weight of 238.36 g/mol. Its IUPAC name is N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-1,3-thiazol-2-amine.
| Compound Name | N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 72528039 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-yl)-1,3-thiazol-2-amine |
| SMILES | CN1CCN2CC(Nc3nccs3)CC2C1 |
| InChI | InChI=1S/C11H18N4S/c1-14-3-4-15-7-9(6-10(15)8-14)13-11-12-2-5-16-11/h2,5,9-10H,3-4,6-8H2,1H3,(H,12,13) |
| InChIKey | PGLWURNYKAVPBH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |