C9H14N4S2 — CID 5377032
4-methyl-N-(1,3-thiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 5377032) has the molecular formula C9H14N4S2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 4-methyl-N-(1,3-thiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-(1,3-thiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 5377032 |
| Molecular Formula | C9H14N4S2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-methyl-N-(1,3-thiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2nccs2)CC1 |
| InChI | InChI=1S/C9H14N4S2/c1-12-3-5-13(6-4-12)9(14)11-8-10-2-7-15-8/h2,7H,3-6H2,1H3,(H,10,11,14) |
| InChIKey | HPTBGSHRNUCENY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|