C22H29N5O3S — CID 133072645
4-(2-acetyl-6-methyl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 133072645) has the molecular formula C22H29N5O3S and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-(2-acetyl-6-methyl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(2-acetyl-6-methyl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 133072645 |
| Molecular Formula | C22H29N5O3S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-(2-acetyl-6-methyl-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(=O)N1CCCN(C)CCN(C(=O)CCC(=O)Nc2nccs2)Cc2ccccc21 |
| InChI | InChI=1S/C22H29N5O3S/c1-17(28)27-12-5-11-25(2)13-14-26(16-18-6-3-4-7-19(18)27)21(30)9-8-20(29)24-22-23-10-15-31-22/h3-4,6-7,10,15H,5,8-9,11-14,16H2,1-2H3,(H,23,24,29) |
| InChIKey | BHBAZKSKIRLUFU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |