C27H38N4O2S — CID 110071512
1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3,3-dimethylbutan-1-one (PubChem CID 110071512) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110071512 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(=O)N1CCC2CCCC(CN(C(=O)CC(C)(C)C)Cc3ccccc31)N2Cc1nccs1 |
| InChI | InChI=1S/C27H38N4O2S/c1-20(32)30-14-12-22-9-7-10-23(31(22)19-25-28-13-15-34-25)18-29(26(33)16-27(2,3)4)17-21-8-5-6-11-24(21)30/h5-6,8,11,13,15,22-23H,7,9-10,12,14,16-19H2,1-4H3 |
| InChIKey | CGMISHHFXFGTCJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |