C29H33ClN4O3S — CID 110071478
1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-2-(4-chlorophenoxy)ethanone (PubChem CID 110071478) has the molecular formula C29H33ClN4O3S and a molecular weight of 553.13 g/mol. Its IUPAC name is 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-2-(4-chlorophenoxy)ethanone.
| Compound Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-2-(4-chlorophenoxy)ethanone |
|---|---|
| PubChem CID | 110071478 |
| Molecular Formula | C29H33ClN4O3S |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 1-[11-acetyl-18-(1,3-thiazol-2-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-3-yl]-2-(4-chlorophenoxy)ethanone |
| SMILES | CC(=O)N1CCC2CCCC(CN(C(=O)COc3ccc(Cl)cc3)Cc3ccccc31)N2Cc1nccs1 |
| InChI | InChI=1S/C29H33ClN4O3S/c1-21(35)33-15-13-24-6-4-7-25(34(24)19-28-31-14-16-38-28)18-32(17-22-5-2-3-8-27(22)33)29(36)20-37-26-11-9-23(30)10-12-26/h2-3,5,8-12,14,16,24-25H,4,6-7,13,15,17-20H2,1H3 |
| InChIKey | QHJHUWOWXCEWGP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |