C32H32ClN5O2 — CID 110066343
1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(quinoxaline-2-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 110066343) has the molecular formula C32H32ClN5O2 and a molecular weight of 554.09 g/mol. Its IUPAC name is 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(quinoxaline-2-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(quinoxaline-2-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 110066343 |
| Molecular Formula | C32H32ClN5O2 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(quinoxaline-2-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2CC[C@@H](CN(C(=O)c3cnc4ccccc4n3)Cc3ccccc31)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H32ClN5O2/c1-22(39)37-17-16-26-14-15-27(38(26)19-23-10-12-25(33)13-11-23)21-36(20-24-6-2-5-9-31(24)37)32(40)30-18-34-28-7-3-4-8-29(28)35-30/h2-13,18,26-27H,14-17,19-21H2,1H3/t26-,27+/m1/s1 |
| InChIKey | BXHXMGDZAJERFQ-SXOMAYOGSA-N |
| XLogP | 5.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |