C28H33N5O2S — CID 110065957
1-[(1R,14S)-17-benzyl-3-(4-ethylthiadiazole-5-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 110065957) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is 1-[(1R,14S)-17-benzyl-3-(4-ethylthiadiazole-5-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1R,14S)-17-benzyl-3-(4-ethylthiadiazole-5-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 110065957 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 1-[(1R,14S)-17-benzyl-3-(4-ethylthiadiazole-5-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | CCc1nnsc1C(=O)N1Cc2ccccc2N(C(C)=O)CC[C@@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C28H33N5O2S/c1-3-25-27(36-30-29-25)28(35)31-18-22-11-7-8-12-26(22)32(20(2)34)16-15-23-13-14-24(19-31)33(23)17-21-9-5-4-6-10-21/h4-12,23-24H,3,13-19H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | AFELBLACFDFGSD-BJKOFHAPSA-N |
| XLogP | 4.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |