C29H34N4O2S — CID 133072959
1-[(1R,14S)-11-acetyl-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 133072959) has the molecular formula C29H34N4O2S and a molecular weight of 502.68 g/mol. Its IUPAC name is 1-[(1R,14S)-11-acetyl-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-[(1R,14S)-11-acetyl-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 133072959 |
| Molecular Formula | C29H34N4O2S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-[(1R,14S)-11-acetyl-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | CC(=O)N1CC[C@@H]2CC[C@H](CN(C(=O)Cc3csc(C)n3)Cc3ccccc31)N2Cc1ccccc1 |
| InChI | InChI=1S/C29H34N4O2S/c1-21-30-25(20-36-21)16-29(35)31-18-24-10-6-7-11-28(24)32(22(2)34)15-14-26-12-13-27(19-31)33(26)17-23-8-4-3-5-9-23/h3-11,20,26-27H,12-19H2,1-2H3/t26-,27+/m0/s1 |
| InChIKey | YZJCWUKYJXDGQA-RRPNLBNLSA-N |
| XLogP | 4.81 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |