C30H33ClN4O2 — CID 110066332
1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(6-methylpyridine-3-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 110066332) has the molecular formula C30H33ClN4O2 and a molecular weight of 517.07 g/mol. Its IUPAC name is 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(6-methylpyridine-3-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(6-methylpyridine-3-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 110066332 |
| Molecular Formula | C30H33ClN4O2 |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-[(1S,14R)-17-[(4-chlorophenyl)methyl]-3-(6-methylpyridine-3-carbonyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2CC[C@@H](CN(C(=O)c3ccc(C)nc3)Cc3ccccc31)N2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H33ClN4O2/c1-21-7-10-24(17-32-21)30(37)33-19-25-5-3-4-6-29(25)34(22(2)36)16-15-27-13-14-28(20-33)35(27)18-23-8-11-26(31)12-9-23/h3-12,17,27-28H,13-16,18-20H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | YCELTHYUAKMMPH-IZLXSDGUSA-N |
| XLogP | 5.48 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |