C33H41N5O3 — CID 133072861
1-[(1S,14R)-3-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 133072861) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is 1-[(1S,14R)-3-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1S,14R)-3-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 133072861 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 1-[(1S,14R)-3-[3-[(dimethylamino)methyl]-4-methoxybenzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | COc1ccc(C(=O)N2Cc3ccccc3N(C(C)=O)CC[C@H]3CC[C@@H](C2)N3Cc2ccncc2)cc1CN(C)C |
| InChI | InChI=1S/C33H41N5O3/c1-24(39)37-18-15-29-10-11-30(38(29)20-25-13-16-34-17-14-25)23-36(22-27-7-5-6-8-31(27)37)33(40)26-9-12-32(41-4)28(19-26)21-35(2)3/h5-9,12-14,16-17,19,29-30H,10-11,15,18,20-23H2,1-4H3/t29-,30+/m1/s1 |
| InChIKey | JOBDDNQKHMZNKG-IHLOFXLRSA-N |
| XLogP | 4.58 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |