C30H32ClFN4O2 — CID 110071606
1-[11-acetyl-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 110071606) has the molecular formula C30H32ClFN4O2 and a molecular weight of 535.06 g/mol. Its IUPAC name is 1-[11-acetyl-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[11-acetyl-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 110071606 |
| Molecular Formula | C30H32ClFN4O2 |
| Molecular Weight | 535.06 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 1-[11-acetyl-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC(=O)N1CCC2CCC(CN(C(=O)Cc3c(F)cccc3Cl)Cc3ccccc31)N2Cc1ccncc1 |
| InChI | InChI=1S/C30H32ClFN4O2/c1-21(37)35-16-13-24-9-10-25(36(24)18-22-11-14-33-15-12-22)20-34(19-23-5-2-3-8-29(23)35)30(38)17-26-27(31)6-4-7-28(26)32/h2-8,11-12,14-15,24-25H,9-10,13,16-20H2,1H3 |
| InChIKey | GCSXXELELPBRGF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.06 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |