C26H34N4O2 — CID 110071399
1-[3-acetyl-18-(pyridin-4-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one (PubChem CID 110071399) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1-[3-acetyl-18-(pyridin-4-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one.
| Compound Name | 1-[3-acetyl-18-(pyridin-4-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
|---|---|
| PubChem CID | 110071399 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1-[3-acetyl-18-(pyridin-4-ylmethyl)-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC2CCCC(CN(C(C)=O)Cc3ccccc31)N2Cc1ccncc1 |
| InChI | InChI=1S/C26H34N4O2/c1-3-26(32)29-16-13-23-8-6-9-24(30(23)17-21-11-14-27-15-12-21)19-28(20(2)31)18-22-7-4-5-10-25(22)29/h4-5,7,10-12,14-15,23-24H,3,6,8-9,13,16-19H2,1-2H3 |
| InChIKey | UFUFBSFBYVQMLP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |