C36H45N5O3 — CID 133073590
1-[(1S,14R)-3-[4-methoxy-3-(piperidin-1-ylmethyl)benzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone (PubChem CID 133073590) has the molecular formula C36H45N5O3 and a molecular weight of 595.79 g/mol. Its IUPAC name is 1-[(1S,14R)-3-[4-methoxy-3-(piperidin-1-ylmethyl)benzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone.
| Compound Name | 1-[(1S,14R)-3-[4-methoxy-3-(piperidin-1-ylmethyl)benzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
|---|---|
| PubChem CID | 133073590 |
| Molecular Formula | C36H45N5O3 |
| Molecular Weight | 595.79 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | 1-[(1S,14R)-3-[4-methoxy-3-(piperidin-1-ylmethyl)benzoyl]-17-(pyridin-4-ylmethyl)-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-11-yl]ethanone |
| SMILES | COc1ccc(C(=O)N2Cc3ccccc3N(C(C)=O)CC[C@H]3CC[C@@H](C2)N3Cc2ccncc2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C36H45N5O3/c1-27(42)40-21-16-32-11-12-33(41(32)23-28-14-17-37-18-15-28)26-39(25-30-8-4-5-9-34(30)40)36(43)29-10-13-35(44-2)31(22-29)24-38-19-6-3-7-20-38/h4-5,8-10,13-15,17-18,22,32-33H,3,6-7,11-12,16,19-21,23-26H2,1-2H3/t32-,33+/m1/s1 |
| InChIKey | RBZHRWYMRRFDJD-SAIUNTKASA-N |
| XLogP | 5.51 |
| TPSA | 69.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.79 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |