C28H37N3O2 — CID 110071794
1-(3-acetyl-18-benzyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl)-2-methylpropan-1-one (PubChem CID 110071794) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 1-(3-acetyl-18-benzyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl)-2-methylpropan-1-one.
| Compound Name | 1-(3-acetyl-18-benzyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 110071794 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 1-(3-acetyl-18-benzyl-3,11,18-triazatricyclo[12.3.1.05,10]octadeca-5,7,9-trien-11-yl)-2-methylpropan-1-one |
| SMILES | CC(=O)N1Cc2ccccc2N(C(=O)C(C)C)CCC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C28H37N3O2/c1-21(2)28(33)30-17-16-25-13-9-14-26(31(25)18-23-10-5-4-6-11-23)20-29(22(3)32)19-24-12-7-8-15-27(24)30/h4-8,10-12,15,21,25-26H,9,13-14,16-20H2,1-3H3 |
| InChIKey | ARNRWGXZVSYHOY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |