C16H22N2O — CID 22057902
1-(9-benzyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethanone (PubChem CID 22057902) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-(9-benzyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethanone.
| Compound Name | 1-(9-benzyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethanone |
|---|---|
| PubChem CID | 22057902 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(9-benzyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)ethanone |
| SMILES | CC(=O)N1CCC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O/c1-13(19)17-10-9-15-7-8-16(12-17)18(15)11-14-5-3-2-4-6-14/h2-6,15-16H,7-12H2,1H3 |
| InChIKey | QSJRLTIPBTXSQN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |