C28H38N4O — CID 110063202
[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 110063202) has the molecular formula C28H38N4O and a molecular weight of 446.64 g/mol. Its IUPAC name is [(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 110063202 |
| Molecular Formula | C28H38N4O |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2Cc3ccccc3NCC[C@@H]3CC[C@H](C2)N3Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H38N4O/c1-30-17-14-23(15-18-30)28(33)31-20-24-9-5-6-10-27(24)29-16-13-25-11-12-26(21-31)32(25)19-22-7-3-2-4-8-22/h2-10,23,25-26,29H,11-21H2,1H3/t25-,26+/m0/s1 |
| InChIKey | FFGYOBSLKOQBSZ-IZZNHLLZSA-N |
| XLogP | 4.21 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |