C30H35N3O3 — CID 110063205
1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methoxyphenoxy)ethanone (PubChem CID 110063205) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methoxyphenoxy)ethanone.
| Compound Name | 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 110063205 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 1-[(1R,14S)-17-benzyl-3,11,17-triazatricyclo[12.2.1.05,10]heptadeca-5,7,9-trien-3-yl]-2-(2-methoxyphenoxy)ethanone |
| SMILES | COc1ccccc1OCC(=O)N1Cc2ccccc2NCC[C@@H]2CC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C30H35N3O3/c1-35-28-13-7-8-14-29(28)36-22-30(34)32-20-24-11-5-6-12-27(24)31-18-17-25-15-16-26(21-32)33(25)19-23-9-3-2-4-10-23/h2-14,25-26,31H,15-22H2,1H3/t25-,26+/m0/s1 |
| InChIKey | WJVQZADDXPIECY-IZZNHLLZSA-N |
| XLogP | 4.95 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |